C15H25ClN2O — CID 114644004
(4-chloro-1-propan-2-ylpyrazol-5-yl)-(4-ethylcyclohexyl)methanol (PubChem CID 114644004) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is (4-chloro-1-propan-2-ylpyrazol-5-yl)-(4-ethylcyclohexyl)methanol.
| Compound Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)-(4-ethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 114644004 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)-(4-ethylcyclohexyl)methanol |
| SMILES | CCC1CCC(C(O)c2c(Cl)cnn2C(C)C)CC1 |
| InChI | InChI=1S/C15H25ClN2O/c1-4-11-5-7-12(8-6-11)15(19)14-13(16)9-17-18(14)10(2)3/h9-12,15,19H,4-8H2,1-3H3 |
| InChIKey | LSCPUUPQSKLINO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |