C16H27ClN2O — CID 114644031
(4-chloro-1-propylpyrazol-5-yl)-(4-propylcyclohexyl)methanol (PubChem CID 114644031) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is (4-chloro-1-propylpyrazol-5-yl)-(4-propylcyclohexyl)methanol.
| Compound Name | (4-chloro-1-propylpyrazol-5-yl)-(4-propylcyclohexyl)methanol |
|---|---|
| PubChem CID | 114644031 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (4-chloro-1-propylpyrazol-5-yl)-(4-propylcyclohexyl)methanol |
| SMILES | CCCC1CCC(C(O)c2c(Cl)cnn2CCC)CC1 |
| InChI | InChI=1S/C16H27ClN2O/c1-3-5-12-6-8-13(9-7-12)16(20)15-14(17)11-18-19(15)10-4-2/h11-13,16,20H,3-10H2,1-2H3 |
| InChIKey | UYERYMDFSCMOEC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |