C22H26N4O3S — CID 11464469
N-(1,3-benzodioxol-5-ylmethyl)-2-morpholin-4-yl-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 11464469) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-morpholin-4-yl-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-morpholin-4-yl-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11464469 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-morpholin-4-yl-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | c1cc2c(cc1CNc1nc(N3CCOCC3)nc3c1C1CCCCC1S3)OCO2 |
| InChI | InChI=1S/C22H26N4O3S/c1-2-4-18-15(3-1)19-20(23-12-14-5-6-16-17(11-14)29-13-28-16)24-22(25-21(19)30-18)26-7-9-27-10-8-26/h5-6,11,15,18H,1-4,7-10,12-13H2,(H,23,24,25) |
| InChIKey | VFRAQVBEXOPFLH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |