C20H20N6O2S — CID 11361824
N-(1,3-benzodioxol-5-ylmethyl)-2-(1,2,4-triazol-1-yl)-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 11361824) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(1,2,4-triazol-1-yl)-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(1,2,4-triazol-1-yl)-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11361824 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(1,2,4-triazol-1-yl)-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | c1ncn(-c2nc(NCc3ccc4c(c3)OCO4)c3c(n2)SC2CCCCC32)n1 |
| InChI | InChI=1S/C20H20N6O2S/c1-2-4-16-13(3-1)17-18(22-8-12-5-6-14-15(7-12)28-11-27-14)24-20(25-19(17)29-16)26-10-21-9-23-26/h5-7,9-10,13,16H,1-4,8,11H2,(H,22,24,25) |
| InChIKey | DXODVFKTNUCQCJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |