C12H9ClF4N2O — CID 114644848
(4-chloro-1-methylpyrazol-5-yl)-[2-fluoro-5-(trifluoromethyl)phenyl]methanol (PubChem CID 114644848) has the molecular formula C12H9ClF4N2O and a molecular weight of 308.66 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-5-yl)-[2-fluoro-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | (4-chloro-1-methylpyrazol-5-yl)-[2-fluoro-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 114644848 |
| Molecular Formula | C12H9ClF4N2O |
| Molecular Weight | 308.66 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (4-chloro-1-methylpyrazol-5-yl)-[2-fluoro-5-(trifluoromethyl)phenyl]methanol |
| SMILES | Cn1ncc(Cl)c1C(O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C12H9ClF4N2O/c1-19-10(8(13)5-18-19)11(20)7-4-6(12(15,16)17)2-3-9(7)14/h2-5,11,20H,1H3 |
| InChIKey | KJJWSVXBDPOWFM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.66 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |