C13H12F4N2O2 — CID 114645117
[5-fluoro-2-(trifluoromethyl)phenyl]-(4-methoxy-1-methylpyrazol-5-yl)methanol (PubChem CID 114645117) has the molecular formula C13H12F4N2O2 and a molecular weight of 304.24 g/mol. Its IUPAC name is [5-fluoro-2-(trifluoromethyl)phenyl]-(4-methoxy-1-methylpyrazol-5-yl)methanol.
| Compound Name | [5-fluoro-2-(trifluoromethyl)phenyl]-(4-methoxy-1-methylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114645117 |
| Molecular Formula | C13H12F4N2O2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [5-fluoro-2-(trifluoromethyl)phenyl]-(4-methoxy-1-methylpyrazol-5-yl)methanol |
| SMILES | COc1cnn(C)c1C(O)c1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H12F4N2O2/c1-19-11(10(21-2)6-18-19)12(20)8-5-7(14)3-4-9(8)13(15,16)17/h3-6,12,20H,1-2H3 |
| InChIKey | QLUIQCUNTCDHFU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |