C15H20FN3O — CID 114646330
N-[(3-fluorophenyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]propan-1-amine (PubChem CID 114646330) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-fluorophenyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114646330 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-[(3-fluorophenyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccc(F)c1)c1c(OC)cnn1C |
| InChI | InChI=1S/C15H20FN3O/c1-4-8-17-14(11-6-5-7-12(16)9-11)15-13(20-3)10-18-19(15)2/h5-7,9-10,14,17H,4,8H2,1-3H3 |
| InChIKey | FVHKVMGOSXDIOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |