C15H19ClFN3O — CID 114650305
N-[(2-chloro-4-fluorophenyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]propan-1-amine (PubChem CID 114650305) has the molecular formula C15H19ClFN3O and a molecular weight of 311.79 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-chloro-4-fluorophenyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114650305 |
| Molecular Formula | C15H19ClFN3O |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(F)cc1Cl)c1c(OC)cnn1C |
| InChI | InChI=1S/C15H19ClFN3O/c1-4-7-18-14(11-6-5-10(17)8-12(11)16)15-13(21-3)9-19-20(15)2/h5-6,8-9,14,18H,4,7H2,1-3H3 |
| InChIKey | SNMSZONVYLFRPS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |