C11H21N3O2 — CID 114648667
N-ethyl-1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methoxyethanamine (PubChem CID 114648667) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is N-ethyl-1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methoxyethanamine.
| Compound Name | N-ethyl-1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 114648667 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | N-ethyl-1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methoxyethanamine |
| SMILES | CCNC(COC)c1c(OC)cnn1CC |
| InChI | InChI=1S/C11H21N3O2/c1-5-12-9(8-15-3)11-10(16-4)7-13-14(11)6-2/h7,9,12H,5-6,8H2,1-4H3 |
| InChIKey | OOXFJNYEMWFHBV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |