C12H23N3O2 — CID 114648681
N-[1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methoxyethyl]propan-1-amine (PubChem CID 114648681) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methoxyethyl]propan-1-amine.
| Compound Name | N-[1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 114648681 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-[1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methoxyethyl]propan-1-amine |
| SMILES | CCCNC(COC)c1c(OC)cnn1CC |
| InChI | InChI=1S/C12H23N3O2/c1-5-7-13-10(9-16-3)12-11(17-4)8-14-15(12)6-2/h8,10,13H,5-7,9H2,1-4H3 |
| InChIKey | IBVBXJZLBUAFKH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |