C15H16N4O — CID 114650377
N-(2-aminophenyl)-4-(2-cyanopyrrol-1-yl)butanamide (PubChem CID 114650377) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-(2-cyanopyrrol-1-yl)butanamide.
| Compound Name | N-(2-aminophenyl)-4-(2-cyanopyrrol-1-yl)butanamide |
|---|---|
| PubChem CID | 114650377 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-(2-aminophenyl)-4-(2-cyanopyrrol-1-yl)butanamide |
| SMILES | N#Cc1cccn1CCCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C15H16N4O/c16-11-12-5-3-9-19(12)10-4-8-15(20)18-14-7-2-1-6-13(14)17/h1-3,5-7,9H,4,8,10,17H2,(H,18,20) |
| InChIKey | WYPKJVIHUJGTAP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|