C16H18N4O — CID 114651952
(1-ethyl-4-methoxypyrazol-5-yl)-isoquinolin-1-ylmethanamine (PubChem CID 114651952) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is (1-ethyl-4-methoxypyrazol-5-yl)-isoquinolin-1-ylmethanamine.
| Compound Name | (1-ethyl-4-methoxypyrazol-5-yl)-isoquinolin-1-ylmethanamine |
|---|---|
| PubChem CID | 114651952 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1-ethyl-4-methoxypyrazol-5-yl)-isoquinolin-1-ylmethanamine |
| SMILES | CCn1ncc(OC)c1C(N)c1nccc2ccccc12 |
| InChI | InChI=1S/C16H18N4O/c1-3-20-16(13(21-2)10-19-20)14(17)15-12-7-5-4-6-11(12)8-9-18-15/h4-10,14H,3,17H2,1-2H3 |
| InChIKey | MOXBJHDDESGNCC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |