C14H26BrN3S — CID 114653804
1-(4-bromo-1-propylpyrazol-5-yl)-2-tert-butylsulfanyl-N-ethylethanamine (PubChem CID 114653804) has the molecular formula C14H26BrN3S and a molecular weight of 348.35 g/mol. Its IUPAC name is 1-(4-bromo-1-propylpyrazol-5-yl)-2-tert-butylsulfanyl-N-ethylethanamine.
| Compound Name | 1-(4-bromo-1-propylpyrazol-5-yl)-2-tert-butylsulfanyl-N-ethylethanamine |
|---|---|
| PubChem CID | 114653804 |
| Molecular Formula | C14H26BrN3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-(4-bromo-1-propylpyrazol-5-yl)-2-tert-butylsulfanyl-N-ethylethanamine |
| SMILES | CCCn1ncc(Br)c1C(CSC(C)(C)C)NCC |
| InChI | InChI=1S/C14H26BrN3S/c1-6-8-18-13(11(15)9-17-18)12(16-7-2)10-19-14(3,4)5/h9,12,16H,6-8,10H2,1-5H3 |
| InChIKey | NRWNETKDWDKOEP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |