C14H27N3S — CID 65133056
2-tert-butylsulfanyl-N-ethyl-1-(2-propylpyrazol-3-yl)ethanamine (PubChem CID 65133056) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-ethyl-1-(2-propylpyrazol-3-yl)ethanamine.
| Compound Name | 2-tert-butylsulfanyl-N-ethyl-1-(2-propylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 65133056 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-tert-butylsulfanyl-N-ethyl-1-(2-propylpyrazol-3-yl)ethanamine |
| SMILES | CCCn1nccc1C(CSC(C)(C)C)NCC |
| InChI | InChI=1S/C14H27N3S/c1-6-10-17-13(8-9-16-17)12(15-7-2)11-18-14(3,4)5/h8-9,12,15H,6-7,10-11H2,1-5H3 |
| InChIKey | FQVMDUOKCCKWKX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |