C25H34N8O — CID 11465395
N-[6-(2-amino-4,5-dihydro-1H-imidazol-5-yl)hexyl]-6-piperazin-1-yl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 11465395) has the molecular formula C25H34N8O and a molecular weight of 462.60 g/mol. Its IUPAC name is N-[6-(2-amino-4,5-dihydro-1H-imidazol-5-yl)hexyl]-6-piperazin-1-yl-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-[6-(2-amino-4,5-dihydro-1H-imidazol-5-yl)hexyl]-6-piperazin-1-yl-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 11465395 |
| Molecular Formula | C25H34N8O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | N-[6-(2-amino-4,5-dihydro-1H-imidazol-5-yl)hexyl]-6-piperazin-1-yl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | NC1=NCC(CCCCCCNC(=O)c2cc3c(cn2)[nH]c2ccc(N4CCNCC4)cc23)N1 |
| InChI | InChI=1S/C25H34N8O/c26-25-30-15-17(31-25)5-3-1-2-4-8-28-24(34)22-14-20-19-13-18(33-11-9-27-10-12-33)6-7-21(19)32-23(20)16-29-22/h6-7,13-14,16-17,27,32H,1-5,8-12,15H2,(H,28,34)(H3,26,30,31) |
| InChIKey | QDYQOIVZCHOSLS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|