C20H24N6O2 — CID 168959392
5-(methylamino)-N-[2-(4-piperazin-1-ylphenyl)ethyl]furo[2,3-c]pyridazine-3-carboxamide (PubChem CID 168959392) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-(methylamino)-N-[2-(4-piperazin-1-ylphenyl)ethyl]furo[2,3-c]pyridazine-3-carboxamide.
| Compound Name | 5-(methylamino)-N-[2-(4-piperazin-1-ylphenyl)ethyl]furo[2,3-c]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 168959392 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-(methylamino)-N-[2-(4-piperazin-1-ylphenyl)ethyl]furo[2,3-c]pyridazine-3-carboxamide |
| SMILES | CNc1coc2nnc(C(=O)NCCc3ccc(N4CCNCC4)cc3)cc12 |
| InChI | InChI=1S/C20H24N6O2/c1-21-18-13-28-20-16(18)12-17(24-25-20)19(27)23-7-6-14-2-4-15(5-3-14)26-10-8-22-9-11-26/h2-5,12-13,21-22H,6-11H2,1H3,(H,23,27) |
| InChIKey | FTURHMRVHRTIJK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|