C23H28N4O — CID 166286647
2-(4-cyano-2,6-dimethylphenyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]acetamide (PubChem CID 166286647) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-(4-cyano-2,6-dimethylphenyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-(4-cyano-2,6-dimethylphenyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 166286647 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-(4-cyano-2,6-dimethylphenyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]acetamide |
| SMILES | Cc1cc(C#N)cc(C)c1CC(=O)NCCc1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C23H28N4O/c1-17-13-20(16-24)14-18(2)22(17)15-23(28)26-8-7-19-3-5-21(6-4-19)27-11-9-25-10-12-27/h3-6,13-14,25H,7-12,15H2,1-2H3,(H,26,28) |
| InChIKey | GJNJFHOCKUEHBU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|