C23H28N6OS — CID 168958574
4-(cyanomethyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]-5-propan-2-ylpyrrolo[2,3-d][1,3]thiazole-2-carboxamide (PubChem CID 168958574) has the molecular formula C23H28N6OS and a molecular weight of 436.59 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]-5-propan-2-ylpyrrolo[2,3-d][1,3]thiazole-2-carboxamide.
| Compound Name | 4-(cyanomethyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]-5-propan-2-ylpyrrolo[2,3-d][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 168958574 |
| Molecular Formula | C23H28N6OS |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-(cyanomethyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]-5-propan-2-ylpyrrolo[2,3-d][1,3]thiazole-2-carboxamide |
| SMILES | CC(C)c1cc2sc(C(=O)NCCc3ccc(N4CCNCC4)cc3)nc2n1CC#N |
| InChI | InChI=1S/C23H28N6OS/c1-16(2)19-15-20-21(29(19)12-8-24)27-23(31-20)22(30)26-9-7-17-3-5-18(6-4-17)28-13-10-25-11-14-28/h3-6,15-16,25H,7,9-14H2,1-2H3,(H,26,30) |
| InChIKey | DSJIHYACOLNIKP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|