C22H29N3O4S — CID 90684309
N-hydroxy-2-methyl-2-methylsulfonyl-4-[4-(4-piperazin-1-ylphenyl)phenyl]butanamide (PubChem CID 90684309) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-methylsulfonyl-4-[4-(4-piperazin-1-ylphenyl)phenyl]butanamide.
| Compound Name | N-hydroxy-2-methyl-2-methylsulfonyl-4-[4-(4-piperazin-1-ylphenyl)phenyl]butanamide |
|---|---|
| PubChem CID | 90684309 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-hydroxy-2-methyl-2-methylsulfonyl-4-[4-(4-piperazin-1-ylphenyl)phenyl]butanamide |
| SMILES | CC(CCc1ccc(-c2ccc(N3CCNCC3)cc2)cc1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H29N3O4S/c1-22(21(26)24-27,30(2,28)29)12-11-17-3-5-18(6-4-17)19-7-9-20(10-8-19)25-15-13-23-14-16-25/h3-10,23,27H,11-16H2,1-2H3,(H,24,26) |
| InChIKey | RULVKMDDMUXBKC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|