C22H29N3O6S — CID 140640861
N-hydroxy-4-[4-[4-(4-hydroxypiperidin-1-yl)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 140640861) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(4-hydroxypiperidin-1-yl)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[4-[4-(4-hydroxypiperidin-1-yl)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 140640861 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-hydroxy-4-[4-[4-(4-hydroxypiperidin-1-yl)phenyl]-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCn1ccc(-c2ccc(N3CCC(O)CC3)cc2)cc1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H29N3O6S/c1-22(21(28)23-29,32(2,30)31)10-14-25-11-7-17(15-20(25)27)16-3-5-18(6-4-16)24-12-8-19(26)9-13-24/h3-7,11,15,19,26,29H,8-10,12-14H2,1-2H3,(H,23,28) |
| InChIKey | LOOJGGYHWGGCSA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|