C15H28N4O2 — CID 114656862
1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methyl-2-morpholin-4-ylbutan-1-amine (PubChem CID 114656862) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methyl-2-morpholin-4-ylbutan-1-amine.
| Compound Name | 1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methyl-2-morpholin-4-ylbutan-1-amine |
|---|---|
| PubChem CID | 114656862 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-(1-ethyl-4-methoxypyrazol-5-yl)-2-methyl-2-morpholin-4-ylbutan-1-amine |
| SMILES | CCn1ncc(OC)c1C(N)C(C)(CC)N1CCOCC1 |
| InChI | InChI=1S/C15H28N4O2/c1-5-15(3,18-7-9-21-10-8-18)14(16)13-12(20-4)11-17-19(13)6-2/h11,14H,5-10,16H2,1-4H3 |
| InChIKey | BOVRLOJXHHIEQP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |