C14H25BrN4 — CID 114656813
1-(4-bromo-1-ethylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylbutan-1-amine (PubChem CID 114656813) has the molecular formula C14H25BrN4 and a molecular weight of 329.29 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylbutan-1-amine.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 114656813 |
| Molecular Formula | C14H25BrN4 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylbutan-1-amine |
| SMILES | CCn1ncc(Br)c1C(N)C(C)(CC)N1CCCC1 |
| InChI | InChI=1S/C14H25BrN4/c1-4-14(3,18-8-6-7-9-18)13(16)12-11(15)10-17-19(12)5-2/h10,13H,4-9,16H2,1-3H3 |
| InChIKey | WRGHQEKOGYXGDJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |