C12H22BrN3O — CID 114661598
1-(4-bromo-1-ethylpyrazol-5-yl)-2-ethoxy-2-methylbutan-1-amine (PubChem CID 114661598) has the molecular formula C12H22BrN3O and a molecular weight of 304.23 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-2-ethoxy-2-methylbutan-1-amine.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-2-ethoxy-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 114661598 |
| Molecular Formula | C12H22BrN3O |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-2-ethoxy-2-methylbutan-1-amine |
| SMILES | CCOC(C)(CC)C(N)c1c(Br)cnn1CC |
| InChI | InChI=1S/C12H22BrN3O/c1-5-12(4,17-7-3)11(14)10-9(13)8-15-16(10)6-2/h8,11H,5-7,14H2,1-4H3 |
| InChIKey | PMFNKYUHSNOWSC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |