C15H29BrN4O — CID 114661659
1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethoxy-2-ethylbutan-1-amine (PubChem CID 114661659) has the molecular formula C15H29BrN4O and a molecular weight of 361.33 g/mol. Its IUPAC name is 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethoxy-2-ethylbutan-1-amine.
| Compound Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethoxy-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 114661659 |
| Molecular Formula | C15H29BrN4O |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-ethoxy-2-ethylbutan-1-amine |
| SMILES | CCOC(CC)(CC)C(N)c1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C15H29BrN4O/c1-6-15(7-2,21-8-3)14(17)13-12(16)11-18-20(13)10-9-19(4)5/h11,14H,6-10,17H2,1-5H3 |
| InChIKey | NVNYDJRWIUYEDA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |