C13H24BrN3O2 — CID 114661608
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethoxy-2-methylbutan-1-amine (PubChem CID 114661608) has the molecular formula C13H24BrN3O2 and a molecular weight of 334.26 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethoxy-2-methylbutan-1-amine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethoxy-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 114661608 |
| Molecular Formula | C13H24BrN3O2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-ethoxy-2-methylbutan-1-amine |
| SMILES | CCOC(C)(CC)C(N)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C13H24BrN3O2/c1-5-13(3,19-6-2)12(15)11-10(14)9-16-17(11)7-8-18-4/h9,12H,5-8,15H2,1-4H3 |
| InChIKey | SWOMZGKMKICQJU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |