C14H26BrN3O — CID 105043059
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-propylpentan-1-amine (PubChem CID 105043059) has the molecular formula C14H26BrN3O and a molecular weight of 332.29 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-propylpentan-1-amine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 105043059 |
| Molecular Formula | C14H26BrN3O |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-propylpentan-1-amine |
| SMILES | CCCC(CCC)C(N)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C14H26BrN3O/c1-4-6-11(7-5-2)13(16)14-12(15)10-17-18(14)8-9-19-3/h10-11,13H,4-9,16H2,1-3H3 |
| InChIKey | RMKSKLBBBORNSO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |