C10H16BrN3O — CID 114660808
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]but-3-en-1-amine (PubChem CID 114660808) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]but-3-en-1-amine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]but-3-en-1-amine |
|---|---|
| PubChem CID | 114660808 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]but-3-en-1-amine |
| SMILES | C=CCC(N)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C10H16BrN3O/c1-3-4-9(12)10-8(11)7-13-14(10)5-6-15-2/h3,7,9H,1,4-6,12H2,2H3 |
| InChIKey | YTINTARIOISZCY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|