C14H17BrFN3O — CID 114648281
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-fluorophenyl)ethanamine (PubChem CID 114648281) has the molecular formula C14H17BrFN3O and a molecular weight of 342.21 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-fluorophenyl)ethanamine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 114648281 |
| Molecular Formula | C14H17BrFN3O |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-(3-fluorophenyl)ethanamine |
| SMILES | COCCn1ncc(Br)c1C(N)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H17BrFN3O/c1-20-6-5-19-14(12(15)9-18-19)13(17)8-10-3-2-4-11(16)7-10/h2-4,7,9,13H,5-6,8,17H2,1H3 |
| InChIKey | PPIXKPVKNPEWGE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |