C11H20BrN3O3 — CID 114032989
1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-(2-methoxyethoxy)ethanamine (PubChem CID 114032989) has the molecular formula C11H20BrN3O3 and a molecular weight of 322.20 g/mol. Its IUPAC name is 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-(2-methoxyethoxy)ethanamine.
| Compound Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-(2-methoxyethoxy)ethanamine |
|---|---|
| PubChem CID | 114032989 |
| Molecular Formula | C11H20BrN3O3 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-2-(2-methoxyethoxy)ethanamine |
| SMILES | COCCOCC(N)c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C11H20BrN3O3/c1-16-4-3-15-11(9(12)7-14-15)10(13)8-18-6-5-17-2/h7,10H,3-6,8,13H2,1-2H3 |
| InChIKey | CCXDMZPRLPFCQA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|