C13H23ClN4 — CID 114656613
1-(4-chloro-1-ethylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylpropan-1-amine (PubChem CID 114656613) has the molecular formula C13H23ClN4 and a molecular weight of 270.81 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 114656613 |
| Molecular Formula | C13H23ClN4 |
| Molecular Weight | 270.81 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-methyl-2-pyrrolidin-1-ylpropan-1-amine |
| SMILES | CCn1ncc(Cl)c1C(N)C(C)(C)N1CCCC1 |
| InChI | InChI=1S/C13H23ClN4/c1-4-18-11(10(14)9-16-18)12(15)13(2,3)17-7-5-6-8-17/h9,12H,4-8,15H2,1-3H3 |
| InChIKey | RYSFTEDDBNPCPQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |