C11H20ClN3 — CID 114648699
1-(4-chloro-1-ethylpyrazol-5-yl)-4-methylpentan-1-amine (PubChem CID 114648699) has the molecular formula C11H20ClN3 and a molecular weight of 229.75 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-4-methylpentan-1-amine.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 114648699 |
| Molecular Formula | C11H20ClN3 |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-4-methylpentan-1-amine |
| SMILES | CCn1ncc(Cl)c1C(N)CCC(C)C |
| InChI | InChI=1S/C11H20ClN3/c1-4-15-11(9(12)7-14-15)10(13)6-5-8(2)3/h7-8,10H,4-6,13H2,1-3H3 |
| InChIKey | AUXDFZMMBRMLCJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |