C13H14Cl2FN3 — CID 114650316
1-(4-chloro-1-ethylpyrazol-5-yl)-2-(2-chloro-6-fluorophenyl)ethanamine (PubChem CID 114650316) has the molecular formula C13H14Cl2FN3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(2-chloro-6-fluorophenyl)ethanamine.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(2-chloro-6-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 114650316 |
| Molecular Formula | C13H14Cl2FN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-(2-chloro-6-fluorophenyl)ethanamine |
| SMILES | CCn1ncc(Cl)c1C(N)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C13H14Cl2FN3/c1-2-19-13(10(15)7-18-19)12(17)6-8-9(14)4-3-5-11(8)16/h3-5,7,12H,2,6,17H2,1H3 |
| InChIKey | QMVBEZGACCMIDC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |