C10H18ClN3O — CID 114660378
1-(4-chloro-1-ethylpyrazol-5-yl)-3-methoxybutan-1-amine (PubChem CID 114660378) has the molecular formula C10H18ClN3O and a molecular weight of 231.73 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-3-methoxybutan-1-amine.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-3-methoxybutan-1-amine |
|---|---|
| PubChem CID | 114660378 |
| Molecular Formula | C10H18ClN3O |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-3-methoxybutan-1-amine |
| SMILES | CCn1ncc(Cl)c1C(N)CC(C)OC |
| InChI | InChI=1S/C10H18ClN3O/c1-4-14-10(8(11)6-13-14)9(12)5-7(2)15-3/h6-7,9H,4-5,12H2,1-3H3 |
| InChIKey | NYSRJGHCUOKBAL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |