C15H27BrN4O — CID 114660263
1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-N-ethyl-2-(oxolan-3-yl)ethanamine (PubChem CID 114660263) has the molecular formula C15H27BrN4O and a molecular weight of 359.31 g/mol. Its IUPAC name is 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-N-ethyl-2-(oxolan-3-yl)ethanamine.
| Compound Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-N-ethyl-2-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 114660263 |
| Molecular Formula | C15H27BrN4O |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-N-ethyl-2-(oxolan-3-yl)ethanamine |
| SMILES | CCNC(CC1CCOC1)c1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C15H27BrN4O/c1-4-17-14(9-12-5-8-21-11-12)15-13(16)10-18-20(15)7-6-19(2)3/h10,12,14,17H,4-9,11H2,1-3H3 |
| InChIKey | ZSHATIKNZCYOHI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |