C14H24ClN3O — CID 114661747
(4-chloro-1-propylpyrazol-5-yl)-(1-ethoxycyclopentyl)methanamine (PubChem CID 114661747) has the molecular formula C14H24ClN3O and a molecular weight of 285.82 g/mol. Its IUPAC name is (4-chloro-1-propylpyrazol-5-yl)-(1-ethoxycyclopentyl)methanamine.
| Compound Name | (4-chloro-1-propylpyrazol-5-yl)-(1-ethoxycyclopentyl)methanamine |
|---|---|
| PubChem CID | 114661747 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (4-chloro-1-propylpyrazol-5-yl)-(1-ethoxycyclopentyl)methanamine |
| SMILES | CCCn1ncc(Cl)c1C(N)C1(OCC)CCCC1 |
| InChI | InChI=1S/C14H24ClN3O/c1-3-9-18-12(11(15)10-17-18)13(16)14(19-4-2)7-5-6-8-14/h10,13H,3-9,16H2,1-2H3 |
| InChIKey | DYQSKDZLEZSMAN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |