C15H26ClN3O — CID 114661932
(4-chloro-1-propylpyrazol-5-yl)-(1-methoxy-4-methylcyclohexyl)methanamine (PubChem CID 114661932) has the molecular formula C15H26ClN3O and a molecular weight of 299.85 g/mol. Its IUPAC name is (4-chloro-1-propylpyrazol-5-yl)-(1-methoxy-4-methylcyclohexyl)methanamine.
| Compound Name | (4-chloro-1-propylpyrazol-5-yl)-(1-methoxy-4-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 114661932 |
| Molecular Formula | C15H26ClN3O |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | (4-chloro-1-propylpyrazol-5-yl)-(1-methoxy-4-methylcyclohexyl)methanamine |
| SMILES | CCCn1ncc(Cl)c1C(N)C1(OC)CCC(C)CC1 |
| InChI | InChI=1S/C15H26ClN3O/c1-4-9-19-13(12(16)10-18-19)14(17)15(20-3)7-5-11(2)6-8-15/h10-11,14H,4-9,17H2,1-3H3 |
| InChIKey | YBJCDDMXNKOOKU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |