C14H24ClN3O2 — CID 114661892
N-[(4-chloro-1-methylpyrazol-5-yl)-(4-methoxyoxan-4-yl)methyl]propan-1-amine (PubChem CID 114661892) has the molecular formula C14H24ClN3O2 and a molecular weight of 301.82 g/mol. Its IUPAC name is N-[(4-chloro-1-methylpyrazol-5-yl)-(4-methoxyoxan-4-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-chloro-1-methylpyrazol-5-yl)-(4-methoxyoxan-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114661892 |
| Molecular Formula | C14H24ClN3O2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-[(4-chloro-1-methylpyrazol-5-yl)-(4-methoxyoxan-4-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1c(Cl)cnn1C)C1(OC)CCOCC1 |
| InChI | InChI=1S/C14H24ClN3O2/c1-4-7-16-13(12-11(15)10-17-18(12)2)14(19-3)5-8-20-9-6-14/h10,13,16H,4-9H2,1-3H3 |
| InChIKey | IOZJJRYBJQGXIG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |