C13H22BrN3O — CID 114662846
2-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methylcyclohexan-1-amine (PubChem CID 114662846) has the molecular formula C13H22BrN3O and a molecular weight of 316.24 g/mol. Its IUPAC name is 2-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methylcyclohexan-1-amine.
| Compound Name | 2-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 114662846 |
| Molecular Formula | C13H22BrN3O |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCCCC1c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C13H22BrN3O/c1-15-12-6-4-3-5-10(12)13-11(14)9-16-17(13)7-8-18-2/h9-10,12,15H,3-8H2,1-2H3 |
| InChIKey | BGMSZNDHMSSLQS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |