C10H16BrN3 — CID 114662893
2-(4-bromo-1-methylpyrazol-5-yl)-N-methylcyclopentan-1-amine (PubChem CID 114662893) has the molecular formula C10H16BrN3 and a molecular weight of 258.16 g/mol. Its IUPAC name is 2-(4-bromo-1-methylpyrazol-5-yl)-N-methylcyclopentan-1-amine.
| Compound Name | 2-(4-bromo-1-methylpyrazol-5-yl)-N-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 114662893 |
| Molecular Formula | C10H16BrN3 |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(4-bromo-1-methylpyrazol-5-yl)-N-methylcyclopentan-1-amine |
| SMILES | CNC1CCCC1c1c(Br)cnn1C |
| InChI | InChI=1S/C10H16BrN3/c1-12-9-5-3-4-7(9)10-8(11)6-13-14(10)2/h6-7,9,12H,3-5H2,1-2H3 |
| InChIKey | IBKOYRYHWIJOKJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |