C13H22BrN3O2 — CID 114666292
(E)-4-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-(2-methoxyethyl)but-3-en-1-amine (PubChem CID 114666292) has the molecular formula C13H22BrN3O2 and a molecular weight of 332.24 g/mol. Its IUPAC name is (E)-4-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-(2-methoxyethyl)but-3-en-1-amine.
| Compound Name | (E)-4-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-(2-methoxyethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 114666292 |
| Molecular Formula | C13H22BrN3O2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (E)-4-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-N-(2-methoxyethyl)but-3-en-1-amine |
| SMILES | COCCNCC/C=C/c1c(Br)cnn1CCOC |
| InChI | InChI=1S/C13H22BrN3O2/c1-18-9-7-15-6-4-3-5-13-12(14)11-16-17(13)8-10-19-2/h3,5,11,15H,4,6-10H2,1-2H3/b5-3+ |
| InChIKey | HOJZLHQHPIFOJN-HWKANZROSA-N |
| XLogP | 1.93 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|