C11H19BrN4 — CID 114666174
(E)-4-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]but-3-en-1-amine (PubChem CID 114666174) has the molecular formula C11H19BrN4 and a molecular weight of 287.21 g/mol. Its IUPAC name is (E)-4-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]but-3-en-1-amine.
| Compound Name | (E)-4-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]but-3-en-1-amine |
|---|---|
| PubChem CID | 114666174 |
| Molecular Formula | C11H19BrN4 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (E)-4-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]but-3-en-1-amine |
| SMILES | CN(C)CCn1ncc(Br)c1/C=C/CCN |
| InChI | InChI=1S/C11H19BrN4/c1-15(2)7-8-16-11(5-3-4-6-13)10(12)9-14-16/h3,5,9H,4,6-8,13H2,1-2H3/b5-3+ |
| InChIKey | NMKKZGRSDUOQIN-HWKANZROSA-N |
| XLogP | 1.57 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |