C14H25ClN4 — CID 114666220
(E)-4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-N-propylbut-3-en-1-amine (PubChem CID 114666220) has the molecular formula C14H25ClN4 and a molecular weight of 284.83 g/mol. Its IUPAC name is (E)-4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-N-propylbut-3-en-1-amine.
| Compound Name | (E)-4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 114666220 |
| Molecular Formula | C14H25ClN4 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (E)-4-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-N-propylbut-3-en-1-amine |
| SMILES | CCCNCC/C=C/c1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C14H25ClN4/c1-4-8-16-9-6-5-7-14-13(15)12-17-19(14)11-10-18(2)3/h5,7,12,16H,4,6,8-11H2,1-3H3/b7-5+ |
| InChIKey | NTRYKQXLXQCURE-FNORWQNLSA-N |
| XLogP | 2.50 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|