C12H10Cl3N3O — CID 114671121
(4-amino-3,5-dichlorophenyl)-(4-chloro-1-ethylpyrazol-5-yl)methanone (PubChem CID 114671121) has the molecular formula C12H10Cl3N3O and a molecular weight of 318.59 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-(4-chloro-1-ethylpyrazol-5-yl)methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-(4-chloro-1-ethylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 114671121 |
| Molecular Formula | C12H10Cl3N3O |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-(4-chloro-1-ethylpyrazol-5-yl)methanone |
| SMILES | CCn1ncc(Cl)c1C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl3N3O/c1-2-18-11(9(15)5-17-18)12(19)6-3-7(13)10(16)8(14)4-6/h3-5H,2,16H2,1H3 |
| InChIKey | MDAUBVZTHDCLOB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|