C13H12BrCl2N3O — CID 114671119
(4-amino-3,5-dichlorophenyl)-(4-bromo-1-propylpyrazol-5-yl)methanone (PubChem CID 114671119) has the molecular formula C13H12BrCl2N3O and a molecular weight of 377.07 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-(4-bromo-1-propylpyrazol-5-yl)methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-(4-bromo-1-propylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 114671119 |
| Molecular Formula | C13H12BrCl2N3O |
| Molecular Weight | 377.07 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-(4-bromo-1-propylpyrazol-5-yl)methanone |
| SMILES | CCCn1ncc(Br)c1C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H12BrCl2N3O/c1-2-3-19-12(8(14)6-18-19)13(20)7-4-9(15)11(17)10(16)5-7/h4-6H,2-3,17H2,1H3 |
| InChIKey | AAJJZGQGUFJYHM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.07 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|