C14H16BrClN4O — CID 114669776
(4-amino-3-chlorophenyl)-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone (PubChem CID 114669776) has the molecular formula C14H16BrClN4O and a molecular weight of 371.67 g/mol. Its IUPAC name is (4-amino-3-chlorophenyl)-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone.
| Compound Name | (4-amino-3-chlorophenyl)-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 114669776 |
| Molecular Formula | C14H16BrClN4O |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | (4-amino-3-chlorophenyl)-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methanone |
| SMILES | CN(C)CCn1ncc(Br)c1C(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C14H16BrClN4O/c1-19(2)5-6-20-13(10(15)8-18-20)14(21)9-3-4-12(17)11(16)7-9/h3-4,7-8H,5-6,17H2,1-2H3 |
| InChIKey | BUDWUFYJHGLWEV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|