C9H6BrFN2OS — CID 114673209
2-(5-bromo-2-fluorophenoxy)-5-methyl-1,3,4-thiadiazole (PubChem CID 114673209) has the molecular formula C9H6BrFN2OS and a molecular weight of 289.13 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenoxy)-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-(5-bromo-2-fluorophenoxy)-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 114673209 |
| Molecular Formula | C9H6BrFN2OS |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 2-(5-bromo-2-fluorophenoxy)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(Oc2cc(Br)ccc2F)s1 |
| InChI | InChI=1S/C9H6BrFN2OS/c1-5-12-13-9(15-5)14-8-4-6(10)2-3-7(8)11/h2-4H,1H3 |
| InChIKey | UYPJEWLQADYICB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |