C10H10BrN3OS — CID 79844147
5-bromo-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)oxy]aniline (PubChem CID 79844147) has the molecular formula C10H10BrN3OS and a molecular weight of 300.18 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)oxy]aniline.
| Compound Name | 5-bromo-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)oxy]aniline |
|---|---|
| PubChem CID | 79844147 |
| Molecular Formula | C10H10BrN3OS |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 5-bromo-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)oxy]aniline |
| SMILES | Cc1nnc(Oc2c(C)cc(Br)cc2N)s1 |
| InChI | InChI=1S/C10H10BrN3OS/c1-5-3-7(11)4-8(12)9(5)15-10-14-13-6(2)16-10/h3-4H,12H2,1-2H3 |
| InChIKey | HFVLJFDBURWYIP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|