C13H10BrNO2S — CID 114674271
6-bromo-2-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydrochromen-4-one (PubChem CID 114674271) has the molecular formula C13H10BrNO2S and a molecular weight of 324.20 g/mol. Its IUPAC name is 6-bromo-2-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-bromo-2-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114674271 |
| Molecular Formula | C13H10BrNO2S |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 6-bromo-2-(2-methyl-1,3-thiazol-4-yl)-2,3-dihydrochromen-4-one |
| SMILES | Cc1nc(C2CC(=O)c3cc(Br)ccc3O2)cs1 |
| InChI | InChI=1S/C13H10BrNO2S/c1-7-15-10(6-18-7)13-5-11(16)9-4-8(14)2-3-12(9)17-13/h2-4,6,13H,5H2,1H3 |
| InChIKey | CQZQMOQRNXUEJS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |