C13H13BrN2O2 — CID 114676360
5-bromo-4-(3-phenylpropoxy)-1H-pyrimidin-6-one (PubChem CID 114676360) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is 5-bromo-4-(3-phenylpropoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(3-phenylpropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114676360 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 5-bromo-4-(3-phenylpropoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(OCCCc2ccccc2)c1Br |
| InChI | InChI=1S/C13H13BrN2O2/c14-11-12(17)15-9-16-13(11)18-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,15,16,17) |
| InChIKey | UQCMBGOYZIQELI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|