C16H15N3O3 — CID 127050455
8-(3-phenylpropoxy)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 127050455) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 8-(3-phenylpropoxy)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 8-(3-phenylpropoxy)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 127050455 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 8-(3-phenylpropoxy)-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2nccc(OCCCc3ccccc3)c2[nH]c1=O |
| InChI | InChI=1S/C16H15N3O3/c20-15-16(21)19-14-13(18-15)12(8-9-17-14)22-10-4-7-11-5-2-1-3-6-11/h1-3,5-6,8-9H,4,7,10H2,(H,18,20)(H,17,19,21) |
| InChIKey | FYYWTFFCRNQOIZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|